Details for 2,5-Dimethylpyrazine
2,5-Dimethylpyrazine
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
123-32-0 |
| EC NO: |
204-618-3 |
| Molecular Formula: |
C6H8N2 |
| Molecular Weight: |
108.1411 |
| Specification: |
|
| InChI: |
InChI=1/C6H8N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H3 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to yellowish liquid |
Aroma of deep-fried or roast potato |
Nut Products, Roast Products, Beverage |
|
| Synonyms: |
Ketine;2,5-Dimethyl-1,4-diazine;2,5-Dimethyl pyrazine;2,5-methyl pyrazine; |
| Molecular Structure: |
 |
if you are sourcing 2,5-Dimethylpyrazine from China ,just feel free to inquire
CN
China Suppliers > tzrunlong > 
Search Product