year
| Category: | Fragrances and Aroma chemicals |
|
||||||
| CAS NO: | 2882-20-4 | |||||||
| EC NO: | 220-736-8;267-918-3 | |||||||
| Molecular Formula: | C6H8N2S | |||||||
| Molecular Weight: | 140.21 | |||||||
| Specification: | ||||||||
| InChI: | InChI=1/C6H8N2S/c1-5-6(9-2)8-4-3-7-5/h3-4H,1-2H3 | |||||||
Product description:
|
||||||||
| Synonyms: | 2-Methyl-3-(methylthio)pyrazine;2-Methyl-3-(methylmercapto)pyrazine;2-Methylmercapto-3-methylpyrazine;2-Methylthio-3-methyl-pyrazine;2-methyl-3-(methylsulfanyl)pyrazine;2-Methylthio-3-methyl pyrazine;2-Methylthio-3,5-Methylpyrazine;2-Methylthio-3(5/6)-methylpyrazine; | |||||||
| Molecular Structure: |
![]() |
|||||||