| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
2179-57-9 |
| EC NO: |
218-548-6 |
| Molecular Formula: |
C6H10S2 |
| Molecular Weight: |
172.17848 |
| Specification: |
|
| InChI: |
InChI=1/C8H12O4/c9-5-1-2-6(10)7-4(5)3-12-8(7)11/h4-7,9-10H,1-3H2 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to pale yellow liquid |
Garlic Flavor |
Soft Drinks, Seasonings |
|
| Synonyms: |
4,5-Dithia-1,7-octadiene;Allyl disulfide;Diallyldisulfide, remainder mainly diallyl sulfide;Disulfide, di-2-propenyl;DADS;Garlicin;3-(prop-2-en-1-yldisulfanyl)prop-1-ene;2-(diphenylphosphanyl)benzaldehyde;4,7-dihydroxyhexahydro-2-benzofuran-1(3H)-one;Diallyl disulphide;Diallyldisulfide; |
| Molecular Structure: |
 |
CN
China Suppliers > tzrunlong > 
Search Product