Details for Butyl butyryllactate

 
Butyl butyryllactate
 
      
        | Category: | 
        Fragrances and Aroma chemicals | 
        
        	 | 
      
      
        | CAS NO: | 
      7492-70-8   | 
      
      
        | EC NO: | 
        
        231-326-3 | 
      
      
        | Molecular Formula: | 
        
        C11H20O4 | 
      
					
					  | Molecular Weight: | 
                      216.2741 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C11H20O4/c1-4-6-8-14-11(13)9(3)15-10(12)7-5-2/h9H,4-8H2,1-3H3 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      Butanoic acid, 2-butoxy-1-methyl-2-oxoethyl ester;Butyl 2-butyroxypropanoate;Butyl butyryl lactate;Lactic acid, butyl ester, butyrate;Butyl butyrolactate;Butyl Butyrylacetate;1-butoxy-1-oxopropan-2-yl butanoate;Butyl Butyral Lactate; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  Butyl butyryllactate from  China ,just feel free to inquire