Details for Methyl 3-methylthiopropionate

Methyl 3-methylthiopropionate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
13532-18-8 |
| EC NO: |
236-883-6 |
| Molecular Formula: |
C5H10O2S |
| Molecular Weight: |
134.1967 |
| Specification: |
|
| InChI: |
InChI=1/C5H10O2S/c1-7-5(6)3-4-8-2/h3-4H2,1-2H3 |
Product description:
| Appearance |
Odor |
Application |
| Achromatic to pale yellow liquid |
Pineapple Aroma |
Beverages, Ice Foods, Roast Products, Candies |
|
| Synonyms: |
Methyl 3-(methylmercapto)propionate~3-(Methylthio)propionic acid methyl ester;3-(Methylmercapto)-propionic acid methyl ester;Methyl 3-methylthiopropionate; Methyl 4-thiapentanoate; Methyl beta-methylmercapto propionate; Methyl beta-methylthiopropionate; ;methyl 3-(methylsulfanyl)propanoate;Methyl-3-(methylthio) propionate; |
| Molecular Structure: |
 |
if you are sourcing Methyl 3-methylthiopropionate from China ,just feel free to inquire