Details for DISPERSE BLUE 3

DISPERSE BLUE 3
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
2475-46-9 |
| EC NO: |
219-604-2 |
| Molecular Formula: |
C17H16N2O3 |
| Molecular Weight: |
296.3205 |
| Specification: |
|
| InChI: |
InChI=1/C17H16N2O3/c1-18-12-6-7-13(19-8-9-20)15-14(12)16(21)10-4-2-3-5-11(10)17(15)22/h2-7,18-20H,8-9H2,1H3 |
| Synonyms: |
C.I. 61505;C.I. Disperse Blue 3;disperse blue 3 (C.I. 61505);1-[(2-hydroxyethyl)amino]-4-(methylamino)anthracene-9,10-dione; |
| Molecular Structure: |
 |
if you are sourcing DISPERSE BLUE 3 from China ,just feel free to inquire