Details for 2-Cyano-4'-methylbiphenyl

2-Cyano-4'-methylbiphenyl
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
114772-53-1 |
| EC NO: |
|
| Molecular Formula: |
C14H11N |
| Molecular Weight: |
193.25 |
| Specification: |
|
| InChI: |
InChI:1S/C14H11N/c1-11-6-8-12(9-7-11)14-5-3-2-4-13(14)10-15/h2-9H,1H3 |
| Synonyms: |
2-Cyano-4-Methylbiphenyl;2-Cyano-4'-Methyl Biphenyl;Otbn;4'-Methyl-2-Cyano-Biphenyl (For Losartan);Akos Bar-1203;4'-Methylbiphenyl-2-Carbonitrile;4'-Methyl-2-Biphenylcarbonitrile;4'-Methyl-2-Cyanobiphenyl;4'-Methyl[1,1'-Biphenyl]-2-Carbonitrile;2-(4-Tolyl)-Benzonitrile;2-(4-Methylphenyl)Benzonitrile;[2-(P-Tolyl)Benzonitrile];4-Methyl-2-Cyanobiphenyl;2-ethynyl-4'-methylbiphenyl;2-Cyamo-4'-methylbiphenyl;Sartanbiphenyl; |
| Molecular Structure: |
 |
if you are sourcing 2-Cyano-4'-methylbiphenyl from China ,just feel free to inquire