Details for 3-phenylpropionic acid

3-phenylpropionic acid
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
501-52-0 |
EC NO: |
207-924-5 |
Molecular Formula: |
C9H10O2 |
Molecular Weight: |
150.1745 |
Specification: |
|
InChI: |
InChI=1/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11) |
Synonyms: |
3-Phenylpropionic acid;3-Phenylpropanoic acid;3-Phenylpropionate;beta-Phenylpropionic Acid;3-phenyl propionic acid;3-Phenyl propanic acid;RARECHEM AL BO 0168;Benzenepropionic acid;3-Phenyl propanoic acid; |
Molecular Structure: |
 |
if you are sourcing 3-phenylpropionic acid from China ,just feel free to inquire