Details for diethyl phenylmalonate

diethyl phenylmalonate
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
83-13-6 |
EC NO: |
201-456-5 |
Molecular Formula: |
C13H16O4 |
Molecular Weight: |
236.2637 |
Specification: |
|
InChI: |
InChI=1/C13H16O4/c1-3-16-12(14)11(13(15)17-4-2)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
Synonyms: |
Phenylmalonic acid diethyl ester;Phenylpropanedioic acid diethyl ester;phenyl diethyl malonate;Diethyl phenyl malonate;
;diethyl phenylpropanedioate; |
Molecular Structure: |
 |
if you are sourcing diethyl phenylmalonate from China ,just feel free to inquire