| Category: |
Other Chemicals |
|
| CAS NO: |
148-01-6 |
| EC NO: |
205-706-4 |
| Molecular Formula: |
C8H7N3O5 |
| Molecular Weight: |
225.1583 |
| Specification: |
≥98.0% |
| InChI: |
InChI=1/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12) |
| Packing: |
25kg/drum |
Product description:
Commodity: Dinitolmide
Other Name: D.O.T Zoalene
CAS#: 148-01-6
Molecular Formula: C8H7N3O5
Molecular Weight: 225.16
Structural Formula:
Characteristics: Appearance light yellow powder, odorless, bitter taste; easily soluble in dimethyl formamide, soluble in acetone, almost insoluble in methanol, ethanol or chloroform; insoluble in water.
Uses: a fodder additive for poultry, used to prevent coccidiosis infections
Specification:
Item Index
Assay
≥98.0%
Melting Point
177~181℃
Loss of Drying
<0.5%
Residue on Ignition
<0.3%
Heavy Metal
<0.00002%
Arsenic
<0.0002%
Packing: 25/fiber drum
|
| Uses: |
a fodder additive for poultry, used to prevent coccidiosis infections |
| Synonyms: |
3,5-Dinitro-o-toluamide = Dinitolmide;Bornylformiat;Zoalene;3,5-Dinitro-o-toluamide;2-methyl-3,5-dinitrobenzamide; |
| Molecular Structure: |
 |