Details for Trimethyl orthoformate

Trimethyl orthoformate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
149-73-5 |
| EC NO: |
205-745-7 |
| Molecular Formula: |
C4H10O3 |
| Molecular Weight: |
106.14 |
| Specification: |
|
| InChI: |
InChI:1S/C4H10O3/c1-5-4(6-2)7-3/h4H,1-3H3 |
| Synonyms: |
Methyl orthoformate;Orthoformic acid trimethyl ester;Thrimethyl orthoformate;Trimethoxymethane;Trimethyl ortho formate;methoxymethanediol;Trimethyl Orthoformate(TMOF); |
| Molecular Structure: |
 |
if you are sourcing Trimethyl orthoformate from China ,just feel free to inquire