Details for Disperse Orange 30

Disperse Orange 30
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
12223-23-3 |
| EC NO: |
226-070-4 |
| Molecular Formula: |
C19H17Cl2N5O4 |
| Molecular Weight: |
450.2754 |
| Specification: |
|
| InChI: |
InChI=1/C19H17Cl2N5O4/c1-13(27)30-10-9-25(8-2-7-22)15-5-3-14(4-6-15)23-24-19-17(20)11-16(26(28)29)12-18(19)21/h3-6,11-12H,2,8-10H2,1H3 |
| Synonyms: |
Disperse Orange 30;Disperse Yellow Brown 2RFL;2-[(2-cyanoethyl){4-[(E)-(2,6-dichloro-4-nitrophenyl)diazenyl]phenyl}amino]ethyl acetate;2-[2-cyanoethyl-[4-(2,6-dichloro-4-nitro-phenyl)azophenyl]amino]ethyl acetate; |
| Molecular Structure: |
 |
if you are sourcing Disperse Orange 30 from China ,just feel free to inquire