Details for Solvent Yellow 2

Solvent Yellow 2
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
60-11-7 |
| EC NO: |
200-455-7 |
| Molecular Formula: |
C14H15N3 |
| Molecular Weight: |
225.289 |
| Specification: |
|
| InChI: |
InChI=1/C14H15N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11H,1-2H3 |
| Synonyms: |
C.I. 11020;C.I. Solvent Yellow 2;C.I. Solvent Yellow 2 (8CI);4-(Dimethylamino)azobenzene;4-Dimethylaminoazobenzene;N,N-Dimethyl-4-phenylazoaniline;Solvent Yellow 2;Dimethyl yellow;Methylgelb;N,N-dimethyl-4-[(E)-phenyldiazenyl]aniline;N,N-dimethyl-4-(phenyldiazenyl)aniline; |
| Molecular Structure: |
 |
if you are sourcing Solvent Yellow 2 from China ,just feel free to inquire