Details for 5-Nitro-2-Methyl benzoic acid

5-Nitro-2-Methyl benzoic acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
1975-52-6 |
| EC NO: |
217-829-0 |
| Molecular Formula: |
C8H6NO4 |
| Molecular Weight: |
180.1381 |
| Specification: |
|
| InChI: |
InChI=1/C8H7NO4/c1-5-2-3-6(9(12)13)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| Synonyms: |
5-Nitro-o-toluic acid;5-nitro-2-methyl benzoic acid;2-methyl-5-nitrobenzoate;2-Methyl-5-Nitro-Benzoic Acid; |
| Molecular Structure: |
 |
if you are sourcing 5-Nitro-2-Methyl benzoic acid from China ,just feel free to inquire