Details for 2,4-DIHYDROXY ACETOPHENONE

2,4-DIHYDROXY ACETOPHENONE
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
89-84-9 |
| EC NO: |
201-945-3 |
| Molecular Formula: |
C8H8O3 |
| Molecular Weight: |
152.1473 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O3/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,9-10H,5H2 |
Product description:
Reddish - brown powder.Reagent for iron as a 10% alcoholic solution. |
| Synonyms: |
2,4-Dihydroxyacetophenone;2,4-Dihydroxy acetophenone; |
| Molecular Structure: |
 |
if you are sourcing 2,4-DIHYDROXY ACETOPHENONE from South-Korea ,just feel free to inquire