Details for 2-Chlorothioxanthone

2-Chlorothioxanthone
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
86-39-5 |
| EC NO: |
201-667-2 |
| Molecular Formula: |
C13H7ClOS |
| Molecular Weight: |
246.7121 |
| Specification: |
|
| InChI: |
InChI=1/C13H7ClOS/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H |
| Synonyms: |
2-Chlorothoxanthone;2-Chlorothioxanthene-9-one;2-chloro-9h-thioxanthen-9-on;2-chloro-9H-Thioxanthen-9-one;KayacureCTX;NissoCureCTX;QuantacureCTX;Sandoray1050;Thioxanthen-9-one,2-chloro-;UCI100;2-Chlorothioxanthone;Photoinitiator-CTX;
|
| Molecular Structure: |
 |
if you are sourcing 2-Chlorothioxanthone from United-States ,just feel free to inquire