Details for 3,5-Dichlorobenzoic acid

3,5-Dichlorobenzoic acid
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
51-36-5 |
EC NO: |
200-092-4 |
Molecular Formula: |
C7H4Cl2O2 |
Molecular Weight: |
190.0041 |
Specification: |
|
InChI: |
InChI=1/C7H4Cl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11)/p-1 |
Product description:
Slightly gray powder.Clean up spills immediately, using the appropriate protective equipment. Sweep up, then place into a suitable container for disposal. Avoid generating dusty conditions. Provide ventilation. |
Synonyms: |
3,5-Dichlorobenzoic;3,5-dichlorobenzoate; |
Molecular Structure: |
 |
if you are sourcing 3,5-Dichlorobenzoic acid from United-States ,just feel free to inquire