| Category: |
Agrochemicals |
|
| CAS NO: |
99-10-5 |
| EC NO: |
202-730-7 |
| Molecular Formula: |
C7H5O4 |
| Molecular Weight: |
153.1127 |
| Specification: |
|
| InChI: |
InChI=1/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11)/p-1 |
| Packing: |
Packed in cardboard drum lined with plastic film, Net weight: 25kg/drum. 32drums/pallet |
Product description:
Chemical Properties:
Melting Point: 235-240℃
Boiling Point: 411.5℃
Flash point: 200℃
Solubility: 84g/L(20 ?C)
Appearance: White Crystal Powder
Application:
Used as organic synthesis intermediates, medicine and synthesis resin.
Packing:
Packed in cardboard drum lined with plastic film, Net weight: 25kg/drum. 32drums/pallet
|
| Uses: |
Used as organic synthesis intermediates, medicine and synthesis resin |
| Synonyms: |
alpha-Resorcylic acid;3,5-dihydroxy-benzoicaci;5-carboxyresorcinol;Benzoicacid,3,5-dihydroxy-;DOHBA;A-RESORCYLIC ACID;ALPHA-RESERCYLIC ACID;3,5-Dihydroxy 3,5-dihydroxybenzoate; |
| Molecular Structure: |
 |