Details for BASIC RED 1

BASIC RED 1
| Category: |
Paint and Coatings |
|
| CAS NO: |
989-38-8 |
| EC NO: |
213-584-9 |
| Molecular Formula: |
C28H30N2O3 |
| Molecular Weight: |
442.5494 |
| Specification: |
|
| InChI: |
InChI=1/C28H30N2O3/c1-6-29-23-15-25-21(13-17(23)4)27(19-11-9-10-12-20(19)28(31)32-8-3)22-14-18(5)24(30-7-2)16-26(22)33-25/h9-16,29H,6-8H2,1-5H3/b30-24+ |
| Synonyms: |
C.I. 45160;C.I. Basic Red 1;C.I. Basic Red 1, monohydrochloride;Basic Red 1;rhodamine 6G (C.I. 45160);rhodamine 6 G;rhodamine 6G (laser dye);rhodamine 6G chloride;rhodamine 6G spray;Basicred;ethyl 2-[(3E)-6-(ethylamino)-3-(ethylimino)-2,7-dimethyl-3H-xanthen-9-yl]benzoate; |
| Molecular Structure: |
 |
if you are sourcing BASIC RED 1 from China ,just feel free to inquire