Details for VIOLET B

VIOLET B
| Category: |
Agrochemicals |
|
| CAS NO: |
81-48-1 |
| EC NO: |
201-353-5 |
| Molecular Formula: |
C21H15NO3 |
| Molecular Weight: |
329.35 |
| Specification: |
|
| InChI: |
InChI=1/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3 |
| Synonyms: |
C.I. 60725;C.I. Disperse Blue 72;C.I. Solvent Violet 13;Alizurol purple;Quinizarin blue;Solvent Violet 13;C.I.Solvent Violet 13;Violet B;Plast violet 4001;C.I.Disperse Blue 72; |
| Molecular Structure: |
 |
if you are sourcing VIOLET B from China ,just feel free to inquire