Details for Diethyl ethoxymethylenemalonate

Diethyl ethoxymethylenemalonate
| Category: |
Intermediates |
|
| CAS NO: |
87-13-8 |
| EC NO: |
201-725-7 |
| Molecular Formula: |
C10H16O5 |
| Molecular Weight: |
216.231 |
| Specification: |
|
| InChI: |
InChI=1/C10H16O5/c1-4-13-7-8(9(11)14-5-2)10(12)15-6-3/h7H,4-6H2,1-3H3 |
| Synonyms: |
Ethoxymethylenmalonic acid diethylester;Propanedioic acid,(ethoxymethylene)-, diethyl ester;Propylene glycol ethoxymethylenemalonate;diethyl (ethoxymethylidene)propanedioate;diethyl 2-(ethoxymethylene)malonate;EMME; |
| Molecular Structure: |
 |
if you are sourcing Diethyl ethoxymethylenemalonate from China ,just feel free to inquire