Details for Tridecyl acrylate

Tridecyl acrylate
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
429625 |
EC NO: |
221-351-8 |
Molecular Formula: |
C16H30O2 |
Molecular Weight: |
254.4082 |
Specification: |
|
InChI: |
InChI=1/C16H30O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-16(17)4-2/h4H,2-3,5-15H2,1H3 |
Synonyms: |
Tridecyl acrylate;2-Propenoic acid tridecyl ester;2-Propenoic acid, tridecyl ester;4-02-00-01468 (Beilstein Handbook Reference);Acrylic acid tridecyl ester;BRN 1780909;HSDB 6078;NSC 6130;Acrylic acid, tridecyl ester;tridecyl prop-2-enoate; |
Molecular Structure: |
 |
if you are sourcing Tridecyl acrylate from China ,just feel free to inquire