Details for Diethyl Phthalate (DEP)

Diethyl Phthalate (DEP)
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
84-66-2 |
| EC NO: |
201-550-6 |
| Molecular Formula: |
C12H14O4 |
| Molecular Weight: |
222.2372 |
| Specification: |
|
| InChI: |
InChI:1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
| Synonyms: |
Ethyl phthalate;Diethyl phthalate, (Phthalic acid diethyl ester);Phthalic Acid Diethyl Ester;DIETHYLPHTALATE;Benzene-1,2-dicarboxylic acid diethyl ester;diethyl benzene-1,2-dicarboxylate;DEP;Diethyl phthalate (DEP); |
| Molecular Structure: |
 |
if you are sourcing Diethyl Phthalate (DEP) from China ,just feel free to inquire