Details for SOLVENT RED 25

SOLVENT RED 25
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
3176-79-2 |
| EC NO: |
221-647-7 |
| Molecular Formula: |
C24H20N4O |
| Molecular Weight: |
380.4418 |
| Specification: |
|
| InChI: |
InChI=1/C24H20N4O/c1-16-6-5-8-19(14-16)25-27-22-12-11-20(15-17(22)2)26-28-24-21-9-4-3-7-18(21)10-13-23(24)29/h3-15,26H,1-2H3/b27-25+,28-24+ |
| Synonyms: |
Solvent Red 25;1-({3-methyl-4-[(E)-(3-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one;(1E)-1-({3-methyl-4-[(E)-(3-methylphenyl)diazenyl]phenyl}hydrazono)naphthalen-2(1H)-one; |
| Molecular Structure: |
 |
if you are sourcing SOLVENT RED 25 from China ,just feel free to inquire