Details for SOLVENT YELLOW 33

SOLVENT YELLOW 33
| Category: |
Intermediates |
|
| CAS NO: |
8003-22-3 |
| EC NO: |
232-318-2 |
| Molecular Formula: |
C18H11NO2 |
| Molecular Weight: |
273.2854 |
| Specification: |
|
| InChI: |
InChI=1/C18H11NO2/c20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15/h1-10,19H |
| Synonyms: |
C.I. Solvent Yellow 33;D & C Yellow no. 11;Yellow PS;2-(quinolin-2-yl)-1H-indene-1,3(2H)-dione;2-quinolin-2(1H)-ylidene-1H-indene-1,3(2H)-dione; |
| Molecular Structure: |
 |
if you are sourcing SOLVENT YELLOW 33 from China ,just feel free to inquire