Details for Dipropylene glycol monomethyl ether

Dipropylene glycol monomethyl ether
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
34590-94-8 |
| EC NO: |
252-104-2 |
| Molecular Formula: |
C7H16O3 |
| Molecular Weight: |
148.2001 |
| Specification: |
|
| InChI: |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
| Synonyms: |
Di(propylene glycol) methyl ether;Methoxypropoxypropanol;Dipropylene glycol monomethyl ether;DPM; |
| Molecular Structure: |
 |
if you are sourcing Dipropylene glycol monomethyl ether from China ,just feel free to inquire