Details for Transparent Yellow 3G

Transparent Yellow 3G
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
4702-90-3 |
| EC NO: |
225-184-1 |
| Molecular Formula: |
C21H18N4O2 |
| Molecular Weight: |
358.3932 |
| Specification: |
|
| InChI: |
InChI=1/C21H18N4O2/c1-14-18(20(26)24(22-14)16-9-5-3-6-10-16)13-19-15(2)23-25(21(19)27)17-11-7-4-8-12-17/h3-13,18H,1-2H3/b19-13+ |
| Synonyms: |
C.I. 48160;C.I. Solvent Yellow 93;Transparent Yellow 3G;C.I.Solvent Yellow 93;Yellow 3G;4,4'-methylylidenebis(5-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one);(4'E)-4,4'-(E)-methylylidenebis(5-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3-one);Plast yellow 1002; |
| Molecular Structure: |
 |
if you are sourcing Transparent Yellow 3G from China ,just feel free to inquire