Details for D-ornithine monohydrochloride

D-ornithine monohydrochloride
| Category: |
Pharmaceuticals and Biochemicals/Vitamin, amino acids and coenzymes |
|
| CAS NO: |
16682-12-5 |
| EC NO: |
240-729-3 |
| Molecular Formula: |
C5H13N2O2 |
| Molecular Weight: |
133.1684 |
| Specification: |
|
| InChI: |
InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p+1/t4-/m1/s1 |
| Synonyms: |
D-(-)-Ornithine hydrochloride;D-Ornithine Monohydrochloride;D-Omithine HCl;D-ornithine hydrochloride (1:1);(2R)-2,5-diammoniopentanoate;D-Ornithine HCL;D-Orn.HCL;H-D-Orn-OH·HCl;R-2,5-Diaminopentanoic Acidhydrochloride; |
| Molecular Structure: |
 |
if you are sourcing D-ornithine monohydrochloride from China ,just feel free to inquire