year
Category: | Food and Feed additives |
|
||||||||||||||
CAS NO: | 52723-61-2 | |||||||||||||||
EC NO: | 258-134-2 | |||||||||||||||
Molecular Formula: | C4H2O4Zn | |||||||||||||||
Molecular Weight: | 179.4653 | |||||||||||||||
Specification: | ||||||||||||||||
InChI: | InChI=1/C4H4O4.Zn/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1-; | |||||||||||||||
Product description:Zinc FumarateCAS No.: 52723-61-2 Zinc is the essential element in animal growth. It plays important function in maintaining animal growth and development, material metabolism and immune function. Zinc Fumarate has completely overcome the defect of inorganic zinc.
Application method and dosage(for each ton of feed): |
||||||||||||||||
Synonyms: | Fumaratezinc;zinc (2Z)-but-2-enedioate; | |||||||||||||||
Molecular Structure: |
![]() |