| Category: |
Pharmaceuticals and Biochemicals/Herbal Plant Extract |
|
| CAS NO: |
501-36-0 |
| EC NO: |
|
| Molecular Formula: |
C14H12O3 |
| Molecular Weight: |
228.2433 |
| Specification: |
Resveratrol 50% 98% 99% |
| InChI: |
InChI=1/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| Packing: |
25kg/Paper Drum |
Product description:
HPLC Resveratrol-Grape Skin Extract
CAS No.: 501-36-0
Active Ingredient: Trans-Resveratrol
Specification: 50% 98% 99%
Test Method: HPLC
Molecular formula: C14H12O3
CAS No.: 501-36-0
Melt Point: 253°C~257°C
Solubility: Poor solubility in water, soluble in aether, chloroform, ethanol, acetic acid and acetone.
Appearance: Fine crystal powder
Color: White
Test Method: HPLC Resveratrol-Grape Skin Extract
CAS No.: 501-36-0
Active Ingredient: Trans-Resveratrol
Specification: 50% 98% 99%
Test Method: HPLC
Molecular formula: C14H12O3
Molecular weight: 228.24
Description:
Red wine extract is the beneficial anti-oxidants extracted from red wine, including resveratrol, and polyphenols. Polyphenol is an organic chemical found in most plant leaves, and is used in dietary supplements or anti-aging products.
Main Functions:
1. Reduce skin irritation caused by inflammation;
2. Inhibit the degradation of collagen in various types of enzymes and other enzymes, anti-aging skin;
|
| Uses: |
Anti-cancer,Anti-dementia |
| Synonyms: |
trans-3,4',5-Trihydroxystilbene;3,4',5-Trihydroxy-trans-stilbene; 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;Veratrum album L alcohol;Trans-Resveratrol;1,3-Benzenediol,5-[(1E)-2-(4-hydroxyphenyl)ethenyl]; |
| Molecular Structure: |
 |