Details for Allyl Heptanoate

Allyl Heptanoate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
142-19-8 |
| EC NO: |
205-527-1 |
| Molecular Formula: |
C10H18O2 |
| Molecular Weight: |
170.2487 |
| Specification: |
|
| InChI: |
InChI=1/C10H18O2/c1-3-5-6-7-8-10(11)12-9-4-2/h4H,2-3,5-9H2,1H3 |
| Synonyms: |
Heptanoic acid, 2-propen-1-yl ester;2-Propenyl heptanoate;AI3-36009;Allyl enanthate;Allyl heptanoate;Allyl heptanoate (natural);Allyl heptoate;Allylester kyseliny enanthove;Allylester kyseliny enanthove [Czech];FEMA No. 2031;Heptanoic acid, 2-propenyl ester;Heptanoic acid, allyl ester;NSC 20969;prop-2-en-1-yl heptanoate; |
| Molecular Structure: |
 |
if you are sourcing Allyl Heptanoate from China ,just feel free to inquire