Details for Butyl Butyryl Lactate

Butyl Butyryl Lactate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
7492-70-8 |
| EC NO: |
231-326-3 |
| Molecular Formula: |
C11H20O4 |
| Molecular Weight: |
216.2741 |
| Specification: |
|
| InChI: |
InChI=1/C11H20O4/c1-4-6-8-14-11(13)9(3)15-10(12)7-5-2/h9H,4-8H2,1-3H3 |
| Synonyms: |
Butanoic acid, 2-butoxy-1-methyl-2-oxoethyl ester;Butyl 2-butyroxypropanoate;Butyl butyryl lactate;Lactic acid, butyl ester, butyrate;Butyl butyrolactate;Butyl Butyrylacetate;1-butoxy-1-oxopropan-2-yl butanoate;Butyl Butyral Lactate; |
| Molecular Structure: |
 |
if you are sourcing Butyl Butyryl Lactate from China ,just feel free to inquire