Details for Ethyl 2-Methyl Butyrate(Natural)

Ethyl 2-Methyl Butyrate(Natural)
Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
7452-79-1 |
EC NO: |
231-225-4 |
Molecular Formula: |
C7H14O2 |
Molecular Weight: |
130.1849 |
Specification: |
|
InChI: |
InChI=1/C7H14O2/c1-4-6(3)7(8)9-5-2/h6H,4-5H2,1-3H3/t6-/m1/s1 |
Synonyms: |
Ethyl 2-methylbutanoate;2-Methylbutyric acid ethyl ester;D-ethyl 2-methylbutyrate;Ethyl 2-Methyl Butyrate;D-Ethyl 2-Methyl Butyrate;ethyl (2R)-2-methylbutanoate; |
Molecular Structure: |
 |
if you are sourcing Ethyl 2-Methyl Butyrate(Natural) from China ,just feel free to inquire