Details for Ethyl Levulinate(Natural)

Ethyl Levulinate(Natural)
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
539-88-8 |
| EC NO: |
208-728-2 |
| Molecular Formula: |
C7H12O3 |
| Molecular Weight: |
144.1684 |
| Specification: |
|
| InChI: |
InChI=1/C7H12O3/c1-3-10-7(9)5-4-6(2)8/h3-5H2,1-2H3 |
| Synonyms: |
Ethyl 4-oxopentanoate;Ethyl 4-oxovalerate;Ethyl levulinate, (4-Ketovaleric acid ethyl ester;Levulinic acid ethyl ester);ethyl laevulate;4-Ketovaleric acid ethyl ester;Levulinic acid ethyl ester;Ethyl-4-oxovalerate: |
| Molecular Structure: |
 |
if you are sourcing Ethyl Levulinate(Natural) from China ,just feel free to inquire