Details for 1,5-Bis(diphenylphosphino)pentane

1,5-Bis(diphenylphosphino)pentane
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
27721-02-4 |
| EC NO: |
|
| Molecular Formula: |
C29H30P2 |
| Molecular Weight: |
440.496 |
| Specification: |
|
| InChI: |
InChI=1/C29H30P2/c1-6-16-26(17-7-1)30(27-18-8-2-9-19-27)24-14-5-15-25-31(28-20-10-3-11-21-28)29-22-12-4-13-23-29/h1-4,6-13,16-23H,5,14-15,24-25H2 |
| Synonyms: |
DPPPE;PENTAMETHYLENEBIS(DIPHENYLPHOSPHINE); |
| Molecular Structure: |
 |
if you are sourcing 1,5-Bis(diphenylphosphino)pentane from Japan ,just feel free to inquire