Details for barban

barban
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
101-27-9 |
| EC NO: |
202-930-4 |
| Molecular Formula: |
C11H9Cl2NO2 |
| Molecular Weight: |
258.1007 |
| Specification: |
|
| InChI: |
InChI=1/C11H9Cl2NO2/c12-6-1-2-7-16-11(15)14-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,(H,14,15) |
| Synonyms: |
(3-Chlorophényl)carbamate de 4-chloro-2-butyn-1-yle;202-930-4;4-Chlorbut-2-in-1-yl-(3-chlorphenyl)carbamat;4-Chloro-2-butyn-1-yl (3-chlorophenyl)carbamate;4-Chlorobut-2-yn-1-yl (3-chlorophenyl)carbamate;carbamic acid, N-(3-chlorophenyl)-, 4-chloro-2-butyn-1-yl ester;chlorinate; |
| Molecular Structure: |
 |
if you are sourcing barban from Japan ,just feel free to inquire