Details for 4-Cyano-4'-butylbiphenyl

4-Cyano-4'-butylbiphenyl
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
52709-83-8 |
| EC NO: |
258-119-0 |
| Molecular Formula: |
C17H17N |
| Molecular Weight: |
235.3236 |
| Specification: |
|
| InChI: |
InChI=1/C17H17N/c1-2-3-4-14-5-9-16(10-6-14)17-11-7-15(13-18)8-12-17/h5-12H,2-4H2,1H3 |
| Synonyms: |
4-n-butyl-4-cyanobiphenyl;4-n-Butyl-4?cyanobiphenyl;4'-butylbiphenyl-4-carbonitrile;4'-Butyl-4-biphenylcarbonitrile;4-Cyano-4'-butylbiphenyl; |
| Molecular Structure: |
 |
if you are sourcing 4-Cyano-4'-butylbiphenyl from United-States ,just feel free to inquire