Details for 4-Fluoro-3-nitrobenzoic acid

4-Fluoro-3-nitrobenzoic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
453-71-4 |
| EC NO: |
207-221-3 |
| Molecular Formula: |
C7H4FNO4 |
| Molecular Weight: |
185.1094 |
| Specification: |
|
| InChI: |
InChI=1/C7H4FNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11) |
| Synonyms: |
1-Fluoro-4-(methylsulfonyl)-2-nitrobenzene;4-Fluoro-3-nitrophenyl methyl sulfone;Benzene, 1-fluoro-4-(methylsulfonyl)-2-nitro-;4-fluoro-3-nitrobenzoate;TIMTEC-BB SBB008336;RARECHEM AL BO 0969;3-Nitro-4-fluorobenzoic acid; |
| Molecular Structure: |
 |
if you are sourcing 4-Fluoro-3-nitrobenzoic acid from United-States ,just feel free to inquire