Details for Phenylboronic acid

Phenylboronic acid
| Category: |
Intermediates |
|
| CAS NO: |
98-80-6 |
| EC NO: |
202-701-9 |
| Molecular Formula: |
C6H7BO2 |
| Molecular Weight: |
121.9296 |
| Specification: |
HPLC>98.0% |
| InChI: |
InChI=1/C6H7BO2/c8-7(9)6-4-2-1-3-5-6/h1-5,8-9H |
| Packing: |
20kg/drum or on request |
Product description:
Chemical Name: Phenylboronic acid
CAS No. 98-80-6
Content: HPLC>98.0%
Appearance: off-white to white powder
Packing: 25kg/drum or on request
Productivity: 5Ton/ M
|
| Uses: |
OLED intermediates, pharmaceutical intermediates |
| Synonyms: |
Benzeneboronicacidanhydride;Phenylboronic acid*;dihydroxy(phenyl)borane;Phenyl Boronic Acid;Phenylboric acid;Benzeneboronic acid;1-PHENYLSULPHONYLINDOLE-5-METHANOL;Phenylboron dihydroxide;acidephenylborique;borophenylicacid; |
| Molecular Structure: |
 |
if you are sourcing Phenylboronic acid from China ,just feel free to inquire