Details for Methyl 3-methoxyacrylate

Methyl 3-methoxyacrylate
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
34846-90-7 |
EC NO: |
412-900-4 |
Molecular Formula: |
C5H8O3 |
Molecular Weight: |
116.1152 |
Specification: |
|
InChI: |
InChI=1/C5H8O3/c1-7-4-3-5(6)8-2/h3-4H,1-2H3/b4-3+ |
Synonyms: |
Methyl trans-3-methoxy acrylate;2-propenoic acid, 3-methoxy-,methyl ester;Methyl 3-methoxy-2-propenoate;Methyl 3-methoxyprop-2-enoate;3-Methoxy-2-propenoic acid methyl ester;Methyl beta-methoxyacrylate;methyl (2E)-3-methoxyprop-2-enoate;3-methoxyacrylic acid methyl ester;Methyl Trans-3-Methoxyacrylate; |
Molecular Structure: |
 |
if you are sourcing Methyl 3-methoxyacrylate from China ,just feel free to inquire