Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
109-99-9 |
EC NO: |
203-726-8 |
Molecular Formula: |
C4H8O |
Molecular Weight: |
72.11 |
Specification: |
|
InChI: |
InChI=1/C13H12O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1,3,5,7H,2,4,6,8H2 |
Packing: |
180kg/drum |
Product description:
Synonyms:THF; oxolane; Sodium tri-sec-butylborohydride; Butane, alpha,delta-oxide; Cyclotetramethylene oxide; Diethylene oxide; Furan, tetrahydro-; Furanidine; 1,2,3,4-tetrahydro-9H-fluoren-9-one
CAS No.:109-99-9
Molecular Formula:C4H8O
|
Uses: |
Solvent for high polymers, especially polyvinyl chloride. As reaction medium for Grignard and metal hydride reactions. In the synthesis of butyrolactone, succinic acid, 1,4-butanediol diacetate. Solvent in histological techniques. |
Synonyms: |
THF;oxolane;Butane, alpha,delta-oxide;Cyclotetramethylene oxide;Diethylene oxide;Furan, tetrahydro-;Furanidine;1,2,3,4-tetrahydro-9H-fluoren-9-one; |
Molecular Structure: |
![Tetrahydrofuran 109-99-9](https://images-a.chemnet.com/suppliers/chembase/440/4404.gif) |