Details for Pigment Yellow 3

Pigment Yellow 3
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
6486-23-3 |
| EC NO: |
229-355-1 |
| Molecular Formula: |
C16H12Cl2N4O4 |
| Molecular Weight: |
395.1969 |
| Specification: |
|
| InChI: |
InChI=1/C16H12Cl2N4O4/c1-9(23)15(16(24)19-12-5-3-2-4-11(12)18)21-20-13-7-6-10(17)8-14(13)22(25)26/h2-8,15H,1H3,(H,19,24) |
| Synonyms: |
C.I. 11710;C.I. Pigment Yellow 3;C.I. Pigment Yellow 3 (VAN) (8CI);Pigment Yellow 3;2-[(E)-(4-chloro-2-nitrophenyl)diazenyl]-N-(2-chlorophenyl)-3-oxobutanamide;2-(4-chloro-2-nitro-phenyl)azo-N-(2-chlorophenyl)-3-oxo-butanamide; |
| Molecular Structure: |
 |
if you are sourcing Pigment Yellow 3 from China ,just feel free to inquire