Details for 2-Chloro-6-methylaniline

2-Chloro-6-methylaniline
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
87-63-8 |
| EC NO: |
201-759-2 |
| Molecular Formula: |
C7H8ClN |
| Molecular Weight: |
141.5981 |
| Specification: |
|
| InChI: |
InChI=1/C7H8ClN/c1-5-3-2-4-6(8)7(5)9/h2-4H,9H2,1H3 |
| Synonyms: |
6-chloro-o-toluidine;2-Amino-3-chlorotoluene;2-Chloro-6-methyl-phenylamine;2-methyl-6-chloro aniline;2-Chloro-6-Methylaninile; |
| Molecular Structure: |
 |
if you are sourcing 2-Chloro-6-methylaniline from United-States ,just feel free to inquire