Details for 2-Benzoylbenzoic acid

2-Benzoylbenzoic acid
| Category: |
Intermediates |
|
| CAS NO: |
85-52-9 |
| EC NO: |
201-612-2 |
| Molecular Formula: |
C14H9O3 |
| Molecular Weight: |
225.22 |
| Specification: |
|
| InChI: |
InChI=1/C14H10O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17/h1-9H,(H,16,17)/p-1 |
| Synonyms: |
2-Beznoylbenzoic acid;2-Carboxybenzophenone;Benzophenone-2-carboxylic acid;2-Carboxybenzophenone;2-(phenylcarbonyl)benzoate;o-Benzoylbenzoic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-Benzoylbenzoic acid from China ,just feel free to inquire