| Category: |
Agrochemicals |
|
| CAS NO: |
CAS:286-20-4 |
| EC NO: |
206-007-7 |
| Molecular Formula: |
C6H10O |
| Molecular Weight: |
98.143 |
| Specification: |
99% min. |
| InChI: |
InChI=1/C6H10O/c1-2-4-6-5(3-1)7-6/h5-6H,1-4H2/t5-,6+ |
| Packing: |
190kg/drum |
Product description:
|
| Uses: |
Mainly used as material for synthesizing mite-killing pesticide, it can be used in synthesizing surface active indicator, rubber assistant and high molecular modifier, too |
| Synonyms: |
7-Oxabicyclo[4.1.0]heptane;Epoxycyclohexane;Cyclohexane Oxide;(1R,6S)-7-oxabicyclo[4.1.0]heptane;1,2-epoxy-cyclohexan;2,3-tetramethyleneoxirane; |
| Molecular Structure: |
 |