| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
50979-18-5 |
| EC NO: |
256-886-6 |
| Molecular Formula: |
CH8N4O3S |
| Molecular Weight: |
156.1642 |
| Specification: |
|
| InChI: |
InChI=1/CH5N3.H3NO3S/c2-1(3)4;1-5(2,3)4/h(H5,2,3,4);(H3,1,2,3,4) |
| Packing: |
Thickening-plastic bags, 25kgs per bag. or Flexible Containers with 500kgs. |
| Uses: |
Nonflammable treatment for wallpapers, fiber, carpets, curtains, and so on. As noninflammable agents of timber, furniture etc. |
| Synonyms: |
Sulfamic acid, compd. with guanidine (1:1);sulfamic acid - guanidine (1:1);Guanidinesulfamate;Guanidine Sulfamate; |
| Molecular Structure: |
 |