Category: |
Catalyst and Auxiliary |
|
CAS NO: |
50979-18-5 |
EC NO: |
256-886-6 |
Molecular Formula: |
CH8N4O3S |
Molecular Weight: |
156.1642 |
Specification: |
|
InChI: |
InChI=1/CH5N3.H3NO3S/c2-1(3)4;1-5(2,3)4/h(H5,2,3,4);(H3,1,2,3,4) |
Packing: |
Thickening-plastic bags, 25kgs per bag. or Flexible Containers with 500kgs. |
Uses: |
Nonflammable treatment for wallpapers, fiber, carpets, curtains, and so on. As noninflammable agents of timber, furniture etc. |
Synonyms: |
Sulfamic acid, compd. with guanidine (1:1);sulfamic acid - guanidine (1:1);Guanidinesulfamate;Guanidine Sulfamate; |
Molecular Structure: |
 |