Details for Diphenyl chlorophosphate

Diphenyl chlorophosphate
| Category: |
Intermediates |
|
| CAS NO: |
2524-64-3 |
| EC NO: |
219-759-6 |
| Molecular Formula: |
C12H10ClO2P |
| Molecular Weight: |
252.6334 |
| Specification: |
|
| InChI: |
InChI=1/C12H10ClO2P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H |
| Synonyms: |
Diphenyl phosphorochloridate;Diphenylphosphoryl Chloride;Diphenyl phosphorochoridate;diphenyl ester;Chlorodiphenoxyphosphine oxide;Diphenoxychlorophosphine oxide;Diphenyl chloridophosphate;Diphenyl phosphochloridate;Diphenylchlorophosphonate;Diphenylphosphoric acid monochloride;Diphenylphosphorus oxychloride;O,O-Diphenyl chlorophosphate;Phosphorochloridic acid diphenyl ester;chlorophosphoric acid diphenyl ester;phosphoric acid diphenyl ester chloride;diphenyl phosphoryl chloride;diphenyl phosphorochloridoite;Phosphorochloridic acid,diphenyl ester;DCP;DPCP; |
| Molecular Structure: |
 |
if you are sourcing Diphenyl chlorophosphate from China ,just feel free to inquire