Details for 2-Fluoro-4-nitrotoluene

- 2-Fluoro-4-nitrotoluene
- 
      - 
        | Category: | Intermediates/Agrochemical intermediates |  |  - 
        | CAS NO: | 1427-07-2 |  - 
        | EC NO: | 215-845-2 |  - 
        | Molecular Formula: | C7H6FNO2 |  - 
					  | Molecular Weight: | 155.1264 |  - 
                      | Specification: |  |  - 
                      | InChI: | InChI=1/C7H6FNO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |  - 
                      | Synonyms: | 2-Fluor-1-methyl-4-nitrobenzol;2-Fluoro-1-methyl-4-nitrobenzene;Benzene, 2-fluoro-1-methyl-4-nitro-;Toluene, 2-fluoro-4-nitro-;2-Fluoro-4-Nitrobenzene; |  - 
                      | Molecular Structure: |  |  
 
 
 
 
if you are sourcing  2-Fluoro-4-nitrotoluene from  China ,just feel free to inquire