Details for 3-Methyl-4-nitrobenzoic acid

3-Methyl-4-nitrobenzoic acid
| Category: |
Intermediates/Dyestuff intermediates |
|
| CAS NO: |
3113-71-1 |
| EC NO: |
221-479-4 |
| Molecular Formula: |
C8H6NO4 |
| Molecular Weight: |
180.1381 |
| Specification: |
|
| InChI: |
InChI=1/C8H7NO4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| Synonyms: |
4-Nitro-m-toluic acid;3-Methy-4-nitrobenzoatic Acid;4-Nitro-3-Methyl benzoic acid;m-Methyl-p-Nitrobenzoic acid;3-methyl-4-nitrobenzoate;RARECHEM AL BO 0346; |
| Molecular Structure: |
 |
if you are sourcing 3-Methyl-4-nitrobenzoic acid from China ,just feel free to inquire