Details for Ethyl acetoacetate

Ethyl acetoacetate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
141-97-9 |
| EC NO: |
205-516-1 |
| Molecular Formula: |
C6H10O3 |
| Molecular Weight: |
130.1344 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O3/c1-3-5(4(2)7)6(8)9/h5H,3H2,1-2H3,(H,8,9)/p-1 |
| Synonyms: |
Acetoacetic ester;Ethyl 3-oxobutanoate;Ethyl acetylacetate;Ethyl beta-ketobutyrate;2-ethyl-3-oxobutanoate;Ethyl 3-Oxobutanate;LABOTEST-BB LT01690211; |
| Molecular Structure: |
 |
if you are sourcing Ethyl acetoacetate from China ,just feel free to inquire